C28H33NO3 — CID 141128183
4-[1-[3-methoxy-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzamide (PubChem CID 141128183) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is 4-[1-[3-methoxy-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzamide.
| Compound Name | 4-[1-[3-methoxy-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 141128183 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 4-[1-[3-methoxy-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzamide |
| SMILES | COc1cc(OC(CC(C)C)c2ccc(C(N)=O)cc2)ccc1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C28H33NO3/c1-18(2)16-26(22-10-12-23(13-11-22)28(29)30)32-24-14-15-25(27(17-24)31-5)21-8-6-20(7-9-21)19(3)4/h6-15,17-19,26H,16H2,1-5H3,(H2,29,30) |
| InChIKey | KQGSGFUJEJTEGT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |