C32H37NO5 — CID 86615986
methyl 3-[[4-[1-[3-formyl-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzoyl]amino]propanoate (PubChem CID 86615986) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is methyl 3-[[4-[1-[3-formyl-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[1-[3-formyl-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 86615986 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | methyl 3-[[4-[1-[3-formyl-4-(4-propan-2-ylphenyl)phenoxy]-3-methylbutyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(C(CC(C)C)Oc2ccc(-c3ccc(C(C)C)cc3)c(C=O)c2)cc1 |
| InChI | InChI=1S/C32H37NO5/c1-21(2)18-30(25-10-12-26(13-11-25)32(36)33-17-16-31(35)37-5)38-28-14-15-29(27(19-28)20-34)24-8-6-23(7-9-24)22(3)4/h6-15,19-22,30H,16-18H2,1-5H3,(H,33,36) |
| InChIKey | YXCDPYSCUVVVQH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|