C16H17F2NO4S — CID 167934307
2-[4-[4-(difluoromethoxy)-2-methoxyphenyl]phenyl]ethanesulfonamide (PubChem CID 167934307) has the molecular formula C16H17F2NO4S and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)-2-methoxyphenyl]phenyl]ethanesulfonamide.
| Compound Name | 2-[4-[4-(difluoromethoxy)-2-methoxyphenyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 167934307 |
| Molecular Formula | C16H17F2NO4S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)-2-methoxyphenyl]phenyl]ethanesulfonamide |
| SMILES | COc1cc(OC(F)F)ccc1-c1ccc(CCS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H17F2NO4S/c1-22-15-10-13(23-16(17)18)6-7-14(15)12-4-2-11(3-5-12)8-9-24(19,20)21/h2-7,10,16H,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | MQXWGGCSRDYKEK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |