C19H22N2O5 — CID 142645741
(2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxybutanediamide (PubChem CID 142645741) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxybutanediamide.
| Compound Name | (2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 142645741 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxybutanediamide |
| SMILES | COc1ccc(-c2ccc(C[C@H](CC(=O)NO)C(N)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-25-15-7-8-16(17(11-15)26-2)13-5-3-12(4-6-13)9-14(19(20)23)10-18(22)21-24/h3-8,11,14,24H,9-10H2,1-2H3,(H2,20,23)(H,21,22)/t14-/m1/s1 |
| InChIKey | ASWHBPVQVGEMCL-CQSZACIVSA-N |
| XLogP | 1.91 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|