C28H30N2O6 — CID 57177409
(2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxy-N-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]butanediamide (PubChem CID 57177409) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is (2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxy-N-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]butanediamide.
| Compound Name | (2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxy-N-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]butanediamide |
|---|---|
| PubChem CID | 57177409 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (2R)-2-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-N'-hydroxy-N-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]butanediamide |
| SMILES | COc1ccc(-c2ccc(C[C@H](CC(=O)NO)C(=O)N[C@]3(O)CCc4ccccc43)cc2)c(OC)c1 |
| InChI | InChI=1S/C28H30N2O6/c1-35-22-11-12-23(25(17-22)36-2)19-9-7-18(8-10-19)15-21(16-26(31)30-34)27(32)29-28(33)14-13-20-5-3-4-6-24(20)28/h3-12,17,21,33-34H,13-16H2,1-2H3,(H,29,32)(H,30,31)/t21-,28+/m1/s1 |
| InChIKey | JZYJJIOKKOYHGR-PIKZIKFNSA-N |
| XLogP | 3.33 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|