C20H23N3O5 — CID 102302981
(2R)-N'-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydroindol-1-yl]-2-[(4-methoxyphenyl)methyl]butanediamide (PubChem CID 102302981) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydroindol-1-yl]-2-[(4-methoxyphenyl)methyl]butanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydroindol-1-yl]-2-[(4-methoxyphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 102302981 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2R)-N'-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydroindol-1-yl]-2-[(4-methoxyphenyl)methyl]butanediamide |
| SMILES | COc1ccc(C[C@H](CC(=O)NO)C(=O)NN2c3ccccc3C[C@H]2O)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-28-16-8-6-13(7-9-16)10-15(11-18(24)22-27)20(26)21-23-17-5-3-2-4-14(17)12-19(23)25/h2-9,15,19,25,27H,10-12H2,1H3,(H,21,26)(H,22,24)/t15-,19-/m1/s1 |
| InChIKey | WFHKGBZNJXZSDQ-DNVCBOLYSA-N |
| XLogP | 1.16 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|