C21H24N2O6 — CID 57170799
N-hydroxy-N'-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]-N'-[(3-hydroxy-4-methoxyphenyl)methyl]butanediamide (PubChem CID 57170799) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-hydroxy-N'-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]-N'-[(3-hydroxy-4-methoxyphenyl)methyl]butanediamide.
| Compound Name | N-hydroxy-N'-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]-N'-[(3-hydroxy-4-methoxyphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 57170799 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-hydroxy-N'-[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]-N'-[(3-hydroxy-4-methoxyphenyl)methyl]butanediamide |
| SMILES | COc1ccc(CN(C(=O)CCC(=O)NO)[C@]2(O)CCc3ccccc32)cc1O |
| InChI | InChI=1S/C21H24N2O6/c1-29-18-7-6-14(12-17(18)24)13-23(20(26)9-8-19(25)22-28)21(27)11-10-15-4-2-3-5-16(15)21/h2-7,12,24,27-28H,8-11,13H2,1H3,(H,22,25)/t21-/m0/s1 |
| InChIKey | OIHBATIOQFUJKV-NRFANRHFSA-N |
| XLogP | 1.81 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|