C12H19ClN2O3 — CID 119301207
3-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-N-methylpropanamide;hydrochloride (PubChem CID 119301207) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is 3-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-N-methylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-N-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119301207 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-N-methylpropanamide;hydrochloride |
| SMILES | COc1ccc(CN(C)C(=O)CCN)cc1O.Cl |
| InChI | InChI=1S/C12H18N2O3.ClH/c1-14(12(16)5-6-13)8-9-3-4-11(17-2)10(15)7-9;/h3-4,7,15H,5-6,8,13H2,1-2H3;1H |
| InChIKey | JODCIWKCUALVHL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |