C14H22N2O4 — CID 120589966
4-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-3-methoxy-N-methylbutanamide (PubChem CID 120589966) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-3-methoxy-N-methylbutanamide.
| Compound Name | 4-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-3-methoxy-N-methylbutanamide |
|---|---|
| PubChem CID | 120589966 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-amino-N-[(3-hydroxy-4-methoxyphenyl)methyl]-3-methoxy-N-methylbutanamide |
| SMILES | COc1ccc(CN(C)C(=O)CC(CN)OC)cc1O |
| InChI | InChI=1S/C14H22N2O4/c1-16(14(18)7-11(8-15)19-2)9-10-4-5-13(20-3)12(17)6-10/h4-6,11,17H,7-9,15H2,1-3H3 |
| InChIKey | VLRHCMLQAHMRMH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |