C12H10F2N2O3 — CID 172780579
3-[4-(difluoromethoxy)-2-methoxyphenyl]-1H-pyridazin-6-one (PubChem CID 172780579) has the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-2-methoxyphenyl]-1H-pyridazin-6-one.
| Compound Name | 3-[4-(difluoromethoxy)-2-methoxyphenyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 172780579 |
| Molecular Formula | C12H10F2N2O3 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-[4-(difluoromethoxy)-2-methoxyphenyl]-1H-pyridazin-6-one |
| SMILES | COc1cc(OC(F)F)ccc1-c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H10F2N2O3/c1-18-10-6-7(19-12(13)14)2-3-8(10)9-4-5-11(17)16-15-9/h2-6,12H,1H3,(H,16,17) |
| InChIKey | OEUKDJGXKPQVQT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |