C16H26N2O2 — CID 63944752
4-(heptan-3-ylamino)-N-(2-hydroxyethyl)benzamide (PubChem CID 63944752) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-(heptan-3-ylamino)-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-(heptan-3-ylamino)-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 63944752 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 4-(heptan-3-ylamino)-N-(2-hydroxyethyl)benzamide |
| SMILES | CCCCC(CC)Nc1ccc(C(=O)NCCO)cc1 |
| InChI | InChI=1S/C16H26N2O2/c1-3-5-6-14(4-2)18-15-9-7-13(8-10-15)16(20)17-11-12-19/h7-10,14,18-19H,3-6,11-12H2,1-2H3,(H,17,20) |
| InChIKey | ZJHZYGMIVCLACK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |