C31H35NO4S — CID 67485943
3-[[4-[7-[4-(3-acetylphenyl)phenyl]sulfanylheptyl]benzoyl]amino]propanoic acid (PubChem CID 67485943) has the molecular formula C31H35NO4S and a molecular weight of 517.69 g/mol. Its IUPAC name is 3-[[4-[7-[4-(3-acetylphenyl)phenyl]sulfanylheptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[7-[4-(3-acetylphenyl)phenyl]sulfanylheptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67485943 |
| Molecular Formula | C31H35NO4S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 3-[[4-[7-[4-(3-acetylphenyl)phenyl]sulfanylheptyl]benzoyl]amino]propanoic acid |
| SMILES | CC(=O)c1cccc(-c2ccc(SCCCCCCCc3ccc(C(=O)NCCC(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C31H35NO4S/c1-23(33)27-9-7-10-28(22-27)25-15-17-29(18-16-25)37-21-6-4-2-3-5-8-24-11-13-26(14-12-24)31(36)32-20-19-30(34)35/h7,9-18,22H,2-6,8,19-21H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | JBVMMSCRFLHREQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|