C32H35F3N2O4 — CID 69289599
2-[[2-[4-[3-(octylcarbamoyl)phenyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-2-oxoacetic acid (PubChem CID 69289599) has the molecular formula C32H35F3N2O4 and a molecular weight of 568.64 g/mol. Its IUPAC name is 2-[[2-[4-[3-(octylcarbamoyl)phenyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[2-[4-[3-(octylcarbamoyl)phenyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 69289599 |
| Molecular Formula | C32H35F3N2O4 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 2-[[2-[4-[3-(octylcarbamoyl)phenyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethyl]amino]-2-oxoacetic acid |
| SMILES | CCCCCCCCNC(=O)c1cccc(-c2ccc(CC(NC(=O)C(=O)O)c3ccc(C(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C32H35F3N2O4/c1-2-3-4-5-6-7-19-36-29(38)26-10-8-9-25(21-26)23-13-11-22(12-14-23)20-28(37-30(39)31(40)41)24-15-17-27(18-16-24)32(33,34)35/h8-18,21,28H,2-7,19-20H2,1H3,(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | AMSGOPDRLQJGDB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|