C27H30BrIN2O2 — CID 87769377
3-bromo-4-[[hydroxy-[(4-iodophenyl)methyl]amino]methyl]-N-[(4-pentylphenyl)methyl]benzamide (PubChem CID 87769377) has the molecular formula C27H30BrIN2O2 and a molecular weight of 621.36 g/mol. Its IUPAC name is 3-bromo-4-[[hydroxy-[(4-iodophenyl)methyl]amino]methyl]-N-[(4-pentylphenyl)methyl]benzamide.
| Compound Name | 3-bromo-4-[[hydroxy-[(4-iodophenyl)methyl]amino]methyl]-N-[(4-pentylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 87769377 |
| Molecular Formula | C27H30BrIN2O2 |
| Molecular Weight | 621.36 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | 3-bromo-4-[[hydroxy-[(4-iodophenyl)methyl]amino]methyl]-N-[(4-pentylphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(CNC(=O)c2ccc(CN(O)Cc3ccc(I)cc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C27H30BrIN2O2/c1-2-3-4-5-20-6-8-21(9-7-20)17-30-27(32)23-12-13-24(26(28)16-23)19-31(33)18-22-10-14-25(29)15-11-22/h6-16,33H,2-5,17-19H2,1H3,(H,30,32) |
| InChIKey | BTWKYZNZYKVFSZ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.36 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|