C15H21F3N2O3 — CID 86925085
1-(3-propan-2-yloxypropyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 86925085) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-(3-propan-2-yloxypropyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-(3-propan-2-yloxypropyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 86925085 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(3-propan-2-yloxypropyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CC(C)OCCCNC(=O)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O3/c1-11(2)22-9-5-8-19-14(21)20-10-12-6-3-4-7-13(12)23-15(16,17)18/h3-4,6-7,11H,5,8-10H2,1-2H3,(H2,19,20,21) |
| InChIKey | GVBSFCHYIGOJBL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|