C17H15N3O3 — CID 47041330
1-(furan-2-ylmethyl)-3-(2-phenoxy-3-pyridinyl)urea (PubChem CID 47041330) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(2-phenoxy-3-pyridinyl)urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(2-phenoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 47041330 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(2-phenoxy-3-pyridinyl)urea |
| SMILES | O=C(NCc1ccco1)Nc1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C17H15N3O3/c21-17(19-12-14-8-5-11-22-14)20-15-9-4-10-18-16(15)23-13-6-2-1-3-7-13/h1-11H,12H2,(H2,19,20,21) |
| InChIKey | ZMMUKSQXHKBPSR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |