C16H18N6O7 — CID 4613437
1-(furan-2-ylmethyl)-3-[2-[2-[(2-methoxy-5-nitrophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]urea (PubChem CID 4613437) has the molecular formula C16H18N6O7 and a molecular weight of 406.36 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[2-[2-[(2-methoxy-5-nitrophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[2-[2-[(2-methoxy-5-nitrophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 4613437 |
| Molecular Formula | C16H18N6O7 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[2-[2-[(2-methoxy-5-nitrophenyl)carbamoyl]hydrazinyl]-2-oxoethyl]urea |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)NNC(=O)CNC(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H18N6O7/c1-28-13-5-4-10(22(26)27)7-12(13)19-16(25)21-20-14(23)9-18-15(24)17-8-11-3-2-6-29-11/h2-7H,8-9H2,1H3,(H,20,23)(H2,17,18,24)(H2,19,21,25) |
| InChIKey | UTVTWHRRGQSPKN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 176.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|