C15H13F2N5OS — CID 9215788
1-[4-(difluoromethoxy)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea (PubChem CID 9215788) has the molecular formula C15H13F2N5OS and a molecular weight of 349.37 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9215788 |
| Molecular Formula | C15H13F2N5OS |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea |
| SMILES | FC(F)Oc1ccc(NC(=S)NCc2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C15H13F2N5OS/c16-14(17)23-11-6-4-10(5-7-11)19-15(24)18-9-13-21-20-12-3-1-2-8-22(12)13/h1-8,14H,9H2,(H2,18,19,24) |
| InChIKey | LIUNRLWUVLYTQH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|