C16H18N6O2S2 — CID 9215710
1-[3-(dimethylsulfamoyl)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea (PubChem CID 9215710) has the molecular formula C16H18N6O2S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9215710 |
| Molecular Formula | C16H18N6O2S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)NCc2nnc3ccccn23)c1 |
| InChI | InChI=1S/C16H18N6O2S2/c1-21(2)26(23,24)13-7-5-6-12(10-13)18-16(25)17-11-15-20-19-14-8-3-4-9-22(14)15/h3-10H,11H2,1-2H3,(H2,17,18,25) |
| InChIKey | NJTVJROVGLQBDL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|