C19H16BrClN4O7 — CID 3510215
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 4-amino-2-[(4-chlorobenzoyl)amino]-4-oxobutanoate (PubChem CID 3510215) has the molecular formula C19H16BrClN4O7 and a molecular weight of 527.72 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 4-amino-2-[(4-chlorobenzoyl)amino]-4-oxobutanoate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 4-amino-2-[(4-chlorobenzoyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 3510215 |
| Molecular Formula | C19H16BrClN4O7 |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 4-amino-2-[(4-chlorobenzoyl)amino]-4-oxobutanoate |
| SMILES | NC(=O)CC(NC(=O)c1ccc(Cl)cc1)C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C19H16BrClN4O7/c20-13-7-12(25(30)31)5-6-14(13)23-17(27)9-32-19(29)15(8-16(22)26)24-18(28)10-1-3-11(21)4-2-10/h1-7,15H,8-9H2,(H2,22,26)(H,23,27)(H,24,28) |
| InChIKey | IFQIIABVTAWQNV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 170.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|