C23H18N4O2S — CID 121080183
N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylbenzimidazole-5-carboxamide (PubChem CID 121080183) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylbenzimidazole-5-carboxamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 121080183 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-phenylbenzimidazole-5-carboxamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc4c(c3)ncn4-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C23H18N4O2S/c1-2-29-17-9-10-18-21(13-17)30-23(25-18)26-22(28)15-8-11-20-19(12-15)24-14-27(20)16-6-4-3-5-7-16/h3-14H,2H2,1H3,(H,25,26,28) |
| InChIKey | OADZUSJOHQMKQV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |