C15H11FN4OS — CID 110522605
2-amino-N-[(Z)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 110522605) has the molecular formula C15H11FN4OS and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-amino-N-[(Z)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-[(Z)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 110522605 |
| Molecular Formula | C15H11FN4OS |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-amino-N-[(Z)-(4-fluorophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)N/N=C\c3ccc(F)cc3)cc2s1 |
| InChI | InChI=1S/C15H11FN4OS/c16-11-4-1-9(2-5-11)8-18-20-14(21)10-3-6-12-13(7-10)22-15(17)19-12/h1-8H,(H2,17,19)(H,20,21)/b18-8- |
| InChIKey | PMQGJVMEBRGBAI-LSCVHKIXSA-N |
| XLogP | 2.78 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|