C15H10Cl2N4O3S — CID 136874279
2-amino-N-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 136874279) has the molecular formula C15H10Cl2N4O3S and a molecular weight of 397.24 g/mol. Its IUPAC name is 2-amino-N-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 136874279 |
| Molecular Formula | C15H10Cl2N4O3S |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-amino-N-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)N/N=C\c3cc(Cl)c(O)c(Cl)c3O)cc2s1 |
| InChI | InChI=1S/C15H10Cl2N4O3S/c16-8-3-7(12(22)11(17)13(8)23)5-19-21-14(24)6-1-2-9-10(4-6)25-15(18)20-9/h1-5,22-23H,(H2,18,20)(H,21,24)/b19-5- |
| InChIKey | SDCJXHHSEATPFF-IPKBDRFQSA-N |
| XLogP | 3.36 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|