C22H25N5O3 — CID 56580134
2,4-dioxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,3-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 56580134) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2,4-dioxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,3-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 2,4-dioxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,3-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 56580134 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2,4-dioxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-1,3-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C1NC(=O)C2(CCC(C(=O)Nc3cccc(-c4cn5c(n4)CCCC5)c3)CC2)N1 |
| InChI | InChI=1S/C22H25N5O3/c28-19(14-7-9-22(10-8-14)20(29)25-21(30)26-22)23-16-5-3-4-15(12-16)17-13-27-11-2-1-6-18(27)24-17/h3-5,12-14H,1-2,6-11H2,(H,23,28)(H2,25,26,29,30) |
| InChIKey | CJOAHIAALIVKAV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|