C21H20N6O3 — CID 56512925
N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 56512925) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 56512925 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C1NC(=O)C2(CCC(C(=O)Nc3ccc(-c4cn5cccnc5n4)cc3)CC2)N1 |
| InChI | InChI=1S/C21H20N6O3/c28-17(14-6-8-21(9-7-14)18(29)25-20(30)26-21)23-15-4-2-13(3-5-15)16-12-27-11-1-10-22-19(27)24-16/h1-5,10-12,14H,6-9H2,(H,23,28)(H2,25,26,29,30) |
| InChIKey | MEVCQFMZRXJHOL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|