C17H9N7 — CID 168610794
2-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168610794) has the molecular formula C17H9N7 and a molecular weight of 311.31 g/mol. Its IUPAC name is 2-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610794 |
| Molecular Formula | C17H9N7 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(-c2cn3cccnc3n2)cc1 |
| InChI | InChI=1S/C17H9N7/c18-8-13(9-19)15(10-20)22-14-4-2-12(3-5-14)16-11-24-7-1-6-21-17(24)23-16/h1-7,11,22H |
| InChIKey | HAAJNEIYLLHSRO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|