C20H18N4 — CID 121335716
N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,5-dimethylaniline (PubChem CID 121335716) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,5-dimethylaniline.
| Compound Name | N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,5-dimethylaniline |
|---|---|
| PubChem CID | 121335716 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2,5-dimethylaniline |
| SMILES | Cc1ccc(C)c(Nc2ccc(-c3cn4cccnc4n3)cc2)c1 |
| InChI | InChI=1S/C20H18N4/c1-14-4-5-15(2)18(12-14)22-17-8-6-16(7-9-17)19-13-24-11-3-10-21-20(24)23-19/h3-13,22H,1-2H3 |
| InChIKey | NSKTZUTYXHZPPT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |