C19H16N4O — CID 121335722
[3-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)phenyl]methanol (PubChem CID 121335722) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is [3-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)phenyl]methanol.
| Compound Name | [3-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)phenyl]methanol |
|---|---|
| PubChem CID | 121335722 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | [3-(4-imidazo[1,2-a]pyrimidin-2-ylanilino)phenyl]methanol |
| SMILES | OCc1cccc(Nc2ccc(-c3cn4cccnc4n3)cc2)c1 |
| InChI | InChI=1S/C19H16N4O/c24-13-14-3-1-4-17(11-14)21-16-7-5-15(6-8-16)18-12-23-10-2-9-20-19(23)22-18/h1-12,21,24H,13H2 |
| InChIKey | TVRGZMMZYHJKIO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |