C16H10N6 — CID 168545526
2-[(4-imidazo[1,2-a]pyrimidin-2-ylanilino)methylidene]propanedinitrile (PubChem CID 168545526) has the molecular formula C16H10N6 and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-[(4-imidazo[1,2-a]pyrimidin-2-ylanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(4-imidazo[1,2-a]pyrimidin-2-ylanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168545526 |
| Molecular Formula | C16H10N6 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[(4-imidazo[1,2-a]pyrimidin-2-ylanilino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(-c2cn3cccnc3n2)cc1 |
| InChI | InChI=1S/C16H10N6/c17-8-12(9-18)10-20-14-4-2-13(3-5-14)15-11-22-7-1-6-19-16(22)21-15/h1-7,10-11,20H |
| InChIKey | AQNIDDJQVGGNCJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|