C21H15ClN4O — CID 55825812
3-(4-chlorophenyl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)prop-2-enamide (PubChem CID 55825812) has the molecular formula C21H15ClN4O and a molecular weight of 374.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55825812 |
| Molecular Formula | C21H15ClN4O |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)Nc1ccc(-c2cn3cccnc3n2)cc1 |
| InChI | InChI=1S/C21H15ClN4O/c22-17-7-2-15(3-8-17)4-11-20(27)24-18-9-5-16(6-10-18)19-14-26-13-1-12-23-21(26)25-19/h1-14H,(H,24,27) |
| InChIKey | DUTRBVKODQOMIT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|