C20H15N5O — CID 75417013
(E)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-pyridin-2-ylprop-2-enamide (PubChem CID 75417013) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is (E)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 75417013 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (E)-N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-3-pyridin-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccn1)Nc1ccc(-c2cn3cccnc3n2)cc1 |
| InChI | InChI=1S/C20H15N5O/c26-19(10-9-16-4-1-2-11-21-16)23-17-7-5-15(6-8-17)18-14-25-13-3-12-22-20(25)24-18/h1-14H,(H,23,26)/b10-9+ |
| InChIKey | QZVPYQDPRSZUCA-MDZDMXLPSA-N |
| XLogP | 3.44 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|