C18H19N5O2 — CID 75499509
N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-morpholin-4-ylacetamide (PubChem CID 75499509) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-morpholin-4-ylacetamide.
| Compound Name | N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 75499509 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-(4-imidazo[1,2-a]pyrimidin-2-ylphenyl)-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc(-c2cn3cccnc3n2)cc1 |
| InChI | InChI=1S/C18H19N5O2/c24-17(13-22-8-10-25-11-9-22)20-15-4-2-14(3-5-15)16-12-23-7-1-6-19-18(23)21-16/h1-7,12H,8-11,13H2,(H,20,24) |
| InChIKey | IELJCKSDXUXVDH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |