C22H20N2OS — CID 154850942
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-methylidenespiro[3.3]heptane-6-carboxamide (PubChem CID 154850942) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-methylidenespiro[3.3]heptane-6-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-methylidenespiro[3.3]heptane-6-carboxamide |
|---|---|
| PubChem CID | 154850942 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-methylidenespiro[3.3]heptane-6-carboxamide |
| SMILES | C=C1CC2(C1)CC(C(=O)Nc1cccc(-c3nc4ccccc4s3)c1)C2 |
| InChI | InChI=1S/C22H20N2OS/c1-14-10-22(11-14)12-16(13-22)20(25)23-17-6-4-5-15(9-17)21-24-18-7-2-3-8-19(18)26-21/h2-9,16H,1,10-13H2,(H,23,25) |
| InChIKey | MALFSQJNJWRQOJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|