C25H23N3O3S2 — CID 16828948
1-(benzenesulfonyl)-N-[3-(1,3-benzothiazol-2-yl)phenyl]piperidine-3-carboxamide (PubChem CID 16828948) has the molecular formula C25H23N3O3S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[3-(1,3-benzothiazol-2-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[3-(1,3-benzothiazol-2-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16828948 |
| Molecular Formula | C25H23N3O3S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[3-(1,3-benzothiazol-2-yl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3s2)c1)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H23N3O3S2/c29-24(19-9-7-15-28(17-19)33(30,31)21-11-2-1-3-12-21)26-20-10-6-8-18(16-20)25-27-22-13-4-5-14-23(22)32-25/h1-6,8,10-14,16,19H,7,9,15,17H2,(H,26,29) |
| InChIKey | CMDLKXPPCXPGDU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |