C21H20F2N2O5S — CID 55471609
4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-(furan-2-ylmethoxy)propyl]benzamide (PubChem CID 55471609) has the molecular formula C21H20F2N2O5S and a molecular weight of 450.46 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-(furan-2-ylmethoxy)propyl]benzamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-(furan-2-ylmethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55471609 |
| Molecular Formula | C21H20F2N2O5S |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-(furan-2-ylmethoxy)propyl]benzamide |
| SMILES | O=C(NCCCOCc1ccco1)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C21H20F2N2O5S/c22-19-9-8-18(13-20(19)23)31(27,28)25-16-6-4-15(5-7-16)21(26)24-10-2-11-29-14-17-3-1-12-30-17/h1,3-9,12-13,25H,2,10-11,14H2,(H,24,26) |
| InChIKey | MDQVJZLTIDOSFE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|