C20H27N3O3 — CID 100641388
5-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]-N-propylbenzamide (PubChem CID 100641388) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 5-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]-N-propylbenzamide.
| Compound Name | 5-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 100641388 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 5-amino-2-[2-(3,4-dimethoxyphenyl)ethylamino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(N)ccc1NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-4-10-23-20(24)16-13-15(21)6-7-17(16)22-11-9-14-5-8-18(25-2)19(12-14)26-3/h5-8,12-13,22H,4,9-11,21H2,1-3H3,(H,23,24) |
| InChIKey | ZYEVLTZLQGQPPL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|