C17H15NO4 — CID 170878016
(E)-3-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 170878016) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (E)-3-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170878016 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (E)-3-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccc(OCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H15NO4/c18-17(19)8-4-12-1-5-14(6-2-12)20-10-13-3-7-15-16(9-13)22-11-21-15/h1-9H,10-11H2,(H2,18,19)/b8-4+ |
| InChIKey | WRBGDWQOMZLZLA-XBXARRHUSA-N |
| XLogP | 2.49 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|