C20H19NO3 — CID 155181144
(E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enamide (PubChem CID 155181144) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155181144 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccc(COc2ccc3c(c2)CCCC3=O)cc1 |
| InChI | InChI=1S/C20H19NO3/c21-20(23)11-8-14-4-6-15(7-5-14)13-24-17-9-10-18-16(12-17)2-1-3-19(18)22/h4-12H,1-3,13H2,(H2,21,23)/b11-8+ |
| InChIKey | LSYGJHABYNFUKR-DHZHZOJOSA-N |
| XLogP | 3.28 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|