C20H18O4 — CID 155168329
(E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enoic acid (PubChem CID 155168329) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155168329 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (E)-3-[4-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxymethyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(COc2ccc3c(c2)CCCC3=O)cc1 |
| InChI | InChI=1S/C20H18O4/c21-19-3-1-2-16-12-17(9-10-18(16)19)24-13-15-6-4-14(5-7-15)8-11-20(22)23/h4-12H,1-3,13H2,(H,22,23)/b11-8+ |
| InChIKey | QOUVHRLVXJAOHY-DHZHZOJOSA-N |
| XLogP | 3.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|