C21H20N6O5 — CID 22536380
1-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 22536380) has the molecular formula C21H20N6O5 and a molecular weight of 436.43 g/mol. Its IUPAC name is 1-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22536380 |
| Molecular Formula | C21H20N6O5 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1-[6-[2-(naphthalene-1-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(NNc1ncnc(N2CCC(C(=O)O)CC2)c1[N+](=O)[O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C21H20N6O5/c28-20(16-7-3-5-13-4-1-2-6-15(13)16)25-24-18-17(27(31)32)19(23-12-22-18)26-10-8-14(9-11-26)21(29)30/h1-7,12,14H,8-11H2,(H,25,28)(H,29,30)(H,22,23,24) |
| InChIKey | ARRXFZITZRWCCM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|