C18H22N4S — CID 51075203
4-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butanenitrile (PubChem CID 51075203) has the molecular formula C18H22N4S and a molecular weight of 326.47 g/mol. Its IUPAC name is 4-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butanenitrile.
| Compound Name | 4-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 51075203 |
| Molecular Formula | C18H22N4S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]butanenitrile |
| SMILES | N#CCCCN1CCN(Cc2csc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C18H22N4S/c19-8-4-5-9-21-10-12-22(13-11-21)14-17-15-23-18(20-17)16-6-2-1-3-7-16/h1-3,6-7,15H,4-5,9-14H2 |
| InChIKey | HRDXJXSSYBDHNB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|