C16H17N3O4S — CID 84592566
methyl 1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 84592566) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is methyl 1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 84592566 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | methyl 1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1Cc1csc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H17N3O4S/c1-23-16(20)14-6-3-7-18(14)9-12-10-24-15(17-12)11-4-2-5-13(8-11)19(21)22/h2,4-5,8,10,14H,3,6-7,9H2,1H3 |
| InChIKey | WMQVDVNKHCISDT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|