C16H21ClN4O2S — CID 120781008
[3-methyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120781008) has the molecular formula C16H21ClN4O2S and a molecular weight of 368.89 g/mol. Its IUPAC name is [3-methyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [3-methyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120781008 |
| Molecular Formula | C16H21ClN4O2S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [3-methyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1(CN)CCN(Cc2csc(-c3cccc([N+](=O)[O-])c3)n2)C1.Cl |
| InChI | InChI=1S/C16H20N4O2S.ClH/c1-16(10-17)5-6-19(11-16)8-13-9-23-15(18-13)12-3-2-4-14(7-12)20(21)22;/h2-4,7,9H,5-6,8,10-11,17H2,1H3;1H |
| InChIKey | GAWMWQUKXYAQBU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|