C17H15ClN4O2 — CID 96540346
2-[(2S)-1-(2-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-benzimidazole (PubChem CID 96540346) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 2-[(2S)-1-(2-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-benzimidazole.
| Compound Name | 2-[(2S)-1-(2-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 96540346 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[(2S)-1-(2-chloro-4-nitrophenyl)pyrrolidin-2-yl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(N2CCC[C@H]2c2nc3ccccc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClN4O2/c18-12-10-11(22(23)24)7-8-15(12)21-9-3-6-16(21)17-19-13-4-1-2-5-14(13)20-17/h1-2,4-5,7-8,10,16H,3,6,9H2,(H,19,20)/t16-/m0/s1 |
| InChIKey | HCUJEPYOLLHMRI-INIZCTEOSA-N |
| XLogP | 4.47 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|