C17H17N5O2 — CID 97223892
2-[(2S)-1-(5-methyl-3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1H-benzimidazole (PubChem CID 97223892) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-[(2S)-1-(5-methyl-3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1H-benzimidazole.
| Compound Name | 2-[(2S)-1-(5-methyl-3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 97223892 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[(2S)-1-(5-methyl-3-nitro-2-pyridinyl)pyrrolidin-2-yl]-1H-benzimidazole |
| SMILES | Cc1cnc(N2CCC[C@H]2c2nc3ccccc3[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N5O2/c1-11-9-15(22(23)24)17(18-10-11)21-8-4-7-14(21)16-19-12-5-2-3-6-13(12)20-16/h2-3,5-6,9-10,14H,4,7-8H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | NUQJDGPBPKEDMY-AWEZNQCLSA-N |
| XLogP | 3.52 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|