C17H20N2O2S — CID 99937922
2-[(2S)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]pyridine (PubChem CID 99937922) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-[(2S)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]pyridine.
| Compound Name | 2-[(2S)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 99937922 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[(2S)-1-[(4-methylsulfonylphenyl)methyl]pyrrolidin-2-yl]pyridine |
| SMILES | CS(=O)(=O)c1ccc(CN2CCC[C@H]2c2ccccn2)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-22(20,21)15-9-7-14(8-10-15)13-19-12-4-6-17(19)16-5-2-3-11-18-16/h2-3,5,7-11,17H,4,6,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | UTQMMWFZNFATLX-KRWDZBQOSA-N |
| XLogP | 2.82 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |