C21H24N4 — CID 99943792
2-[(2S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-2-yl]pyridine (PubChem CID 99943792) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-[(2S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-2-yl]pyridine.
| Compound Name | 2-[(2S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 99943792 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[(2S)-1-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-2-yl]pyridine |
| SMILES | c1ccc([C@@H]2CCCCN2Cc2ccc(Cn3cccn3)cc2)nc1 |
| InChI | InChI=1S/C21H24N4/c1-3-12-22-20(6-1)21-7-2-4-14-24(21)16-18-8-10-19(11-9-18)17-25-15-5-13-23-25/h1,3,5-6,8-13,15,21H,2,4,7,14,16-17H2/t21-/m0/s1 |
| InChIKey | BGRSOKNCSLCOJQ-NRFANRHFSA-N |
| XLogP | 4.05 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |