C18H21N3O2 — CID 95189473
(2R)-1-methyl-4-[(3-pyridin-2-ylphenyl)methyl]piperazine-2-carboxylic acid (PubChem CID 95189473) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2R)-1-methyl-4-[(3-pyridin-2-ylphenyl)methyl]piperazine-2-carboxylic acid.
| Compound Name | (2R)-1-methyl-4-[(3-pyridin-2-ylphenyl)methyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 95189473 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2R)-1-methyl-4-[(3-pyridin-2-ylphenyl)methyl]piperazine-2-carboxylic acid |
| SMILES | CN1CCN(Cc2cccc(-c3ccccn3)c2)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C18H21N3O2/c1-20-9-10-21(13-17(20)18(22)23)12-14-5-4-6-15(11-14)16-7-2-3-8-19-16/h2-8,11,17H,9-10,12-13H2,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | NDKFBYUITWXIKY-QGZVFWFLSA-N |
| XLogP | 1.95 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |