C22H34N2O4 — CID 122043592
2-[[4-[[3-(cyclohexylmethoxy)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 122043592) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-[[4-[[3-(cyclohexylmethoxy)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[[3-(cyclohexylmethoxy)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 122043592 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 2-[[4-[[3-(cyclohexylmethoxy)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(Cc2cccc(OCC3CCCCC3)c2)CCO1 |
| InChI | InChI=1S/C22H34N2O4/c1-23(16-22(25)26)14-21-15-24(10-11-27-21)13-19-8-5-9-20(12-19)28-17-18-6-3-2-4-7-18/h5,8-9,12,18,21H,2-4,6-7,10-11,13-17H2,1H3,(H,25,26) |
| InChIKey | PIQCTHXDOMABBY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |