C25H38N4O4 — CID 10389448
[4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone (PubChem CID 10389448) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is [4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone.
| Compound Name | [4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 10389448 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | [4-(morpholine-4-carbonyl)-1,4-diazepan-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCCCN2CCCCC2)cc1)N1CCCN(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C25H38N4O4/c30-24(27-13-4-14-28(16-15-27)25(31)29-17-20-32-21-18-29)22-6-8-23(9-7-22)33-19-5-12-26-10-2-1-3-11-26/h6-9H,1-5,10-21H2 |
| InChIKey | OQTAARCJDVWSSD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|